C15H15N5OS — CID 95904281
1-[(1R)-1-(3-pyrazol-1-ylphenyl)ethyl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 95904281) has the molecular formula C15H15N5OS and a molecular weight of 313.39 g/mol. Its IUPAC name is 1-[(1R)-1-(3-pyrazol-1-ylphenyl)ethyl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[(1R)-1-(3-pyrazol-1-ylphenyl)ethyl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 95904281 |
| Molecular Formula | C15H15N5OS |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 1-[(1R)-1-(3-pyrazol-1-ylphenyl)ethyl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | C[C@@H](NC(=O)Nc1nccs1)c1cccc(-n2cccn2)c1 |
| InChI | InChI=1S/C15H15N5OS/c1-11(18-14(21)19-15-16-7-9-22-15)12-4-2-5-13(10-12)20-8-3-6-17-20/h2-11H,1H3,(H2,16,18,19,21)/t11-/m1/s1 |
| InChIKey | FPKHNRQHCVRFEU-LLVKDONJSA-N |
| XLogP | 3.21 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |