C14H24BrN3O — CID 63888921
N-(1-amino-4-methylpentan-2-yl)-4-bromo-1-propan-2-ylpyrrole-2-carboxamide (PubChem CID 63888921) has the molecular formula C14H24BrN3O and a molecular weight of 330.27 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-4-bromo-1-propan-2-ylpyrrole-2-carboxamide.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-4-bromo-1-propan-2-ylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 63888921 |
| Molecular Formula | C14H24BrN3O |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-4-bromo-1-propan-2-ylpyrrole-2-carboxamide |
| SMILES | CC(C)CC(CN)NC(=O)c1cc(Br)cn1C(C)C |
| InChI | InChI=1S/C14H24BrN3O/c1-9(2)5-12(7-16)17-14(19)13-6-11(15)8-18(13)10(3)4/h6,8-10,12H,5,7,16H2,1-4H3,(H,17,19) |
| InChIKey | MYQQANAECGFPAF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |