C19H18F4N2O4S — CID 55480057
2-fluoro-N-[4-methyl-3-(trifluoromethyl)phenyl]-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 55480057) has the molecular formula C19H18F4N2O4S and a molecular weight of 446.42 g/mol. Its IUPAC name is 2-fluoro-N-[4-methyl-3-(trifluoromethyl)phenyl]-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 2-fluoro-N-[4-methyl-3-(trifluoromethyl)phenyl]-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55480057 |
| Molecular Formula | C19H18F4N2O4S |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 2-fluoro-N-[4-methyl-3-(trifluoromethyl)phenyl]-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | Cc1ccc(NC(=O)c2cc(S(=O)(=O)N3CCOCC3)ccc2F)cc1C(F)(F)F |
| InChI | InChI=1S/C19H18F4N2O4S/c1-12-2-3-13(10-16(12)19(21,22)23)24-18(26)15-11-14(4-5-17(15)20)30(27,28)25-6-8-29-9-7-25/h2-5,10-11H,6-9H2,1H3,(H,24,26) |
| InChIKey | GGKHGXDCVVOVES-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |