C18H20Cl2N2O4S — CID 16658180
tert-butyl (2S)-1-(1,4-dichloroisoquinolin-7-yl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 16658180) has the molecular formula C18H20Cl2N2O4S and a molecular weight of 431.34 g/mol. Its IUPAC name is tert-butyl (2S)-1-(1,4-dichloroisoquinolin-7-yl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-(1,4-dichloroisoquinolin-7-yl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 16658180 |
| Molecular Formula | C18H20Cl2N2O4S |
| Molecular Weight | 431.34 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | tert-butyl (2S)-1-(1,4-dichloroisoquinolin-7-yl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCCN1S(=O)(=O)c1ccc2c(Cl)cnc(Cl)c2c1 |
| InChI | InChI=1S/C18H20Cl2N2O4S/c1-18(2,3)26-17(23)15-5-4-8-22(15)27(24,25)11-6-7-12-13(9-11)16(20)21-10-14(12)19/h6-7,9-10,15H,4-5,8H2,1-3H3/t15-/m0/s1 |
| InChIKey | NNPRSJWMOALALA-HNNXBMFYSA-N |
| XLogP | 4.04 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|