About ditert-butyl (3S)-2-[(4-hydroxyphenyl)sulfonylmethyl]piperidine-1,3-dicarboxylate
ditert-butyl (3S)-2-[(4-hydroxyphenyl)sulfonylmethyl]piperidine-1,3-dicarboxylate (PubChem CID 91547682) has the molecular formula C22H33NO7S
and a molecular weight of 455.57 g/mol. Its IUPAC name is ditert-butyl (3S)-2-[(4-hydroxyphenyl)sulfonylmethyl]piperidine-1,3-dicarboxylate.
Molecular Properties
| Compound Name | ditert-butyl (3S)-2-[(4-hydroxyphenyl)sulfonylmethyl]piperidine-1,3-dicarboxylate |
| PubChem CID | 91547682 |
| Molecular Formula | C22H33NO7S |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | ditert-butyl (3S)-2-[(4-hydroxyphenyl)sulfonylmethyl]piperidine-1,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1CCCN(C(=O)OC(C)(C)C)C1CS(=O)(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C22H33NO7S/c1-21(2,3)29-19(25)17-8-7-13-23(20(26)30-22(4,5)6)18(17)14-31(27,28)16-11-9-15(24)10-12-16/h9-12,17-18,24H,7-8,13-14H2,1-6H3/t17-,18?/m0/s1 |
| InChIKey | XLDVDVNFTOUNAK-ZENAZSQFSA-N |
| XLogP | 3.52 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ditert-butyl (3S)-2-[(4-hydroxyphenyl)sulfonylmethyl]piperidine-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl (3S)-2-[(4-hydroxyphenyl)sulfonylmethyl]piperidine-1,3-dicarboxylate?
The IUPAC name of ditert-butyl (3S)-2-[(4-hydroxyphenyl)sulfonylmethyl]piperidine-1,3-dicarboxylate (CID 91547682) is ditert-butyl (3S)-2-[(4-hydroxyphenyl)sulfonylmethyl]piperidine-1,3-dicarboxylate.
What is the SMILES notation for ditert-butyl (3S)-2-[(4-hydroxyphenyl)sulfonylmethyl]piperidine-1,3-dicarboxylate?
The canonical SMILES for ditert-butyl (3S)-2-[(4-hydroxyphenyl)sulfonylmethyl]piperidine-1,3-dicarboxylate is CC(C)(C)OC(=O)[C@H]1CCCN(C(=O)OC(C)(C)C)C1CS(=O)(=O)c1ccc(O)cc1.
What is the InChIKey of ditert-butyl (3S)-2-[(4-hydroxyphenyl)sulfonylmethyl]piperidine-1,3-dicarboxylate?
The InChIKey is XLDVDVNFTOUNAK-ZENAZSQFSA-N. The full InChI is InChI=1S/C22H33NO7S/c1-21(2,3)29-19(25)17-8-7-13-23(20(26)30-22(4,5)6)18(17)14-31(27,28)16-11-9-15(24)10-12-16/h9-12,17-18,24H,7-8,13-14H2,1-6H3/t17-,18?/m0/s1.
What are the key properties of ditert-butyl (3S)-2-[(4-hydroxyphenyl)sulfonylmethyl]piperidine-1,3-dicarboxylate?
ditert-butyl (3S)-2-[(4-hydroxyphenyl)sulfonylmethyl]piperidine-1,3-dicarboxylate has a molecular weight of 455.57 g/mol, XLogP of 3.52, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl (3S)-2-[(4-hydroxyphenyl)sulfonylmethyl]piperidine-1,3-dicarboxylate is sourced from PubChem (CID 91547682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).