C17H31NO5 — CID 171364155
ditert-butyl (3R)-2-methoxyazepane-1,3-dicarboxylate (PubChem CID 171364155) has the molecular formula C17H31NO5 and a molecular weight of 329.44 g/mol. Its IUPAC name is ditert-butyl (3R)-2-methoxyazepane-1,3-dicarboxylate.
| Compound Name | ditert-butyl (3R)-2-methoxyazepane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 171364155 |
| Molecular Formula | C17H31NO5 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | ditert-butyl (3R)-2-methoxyazepane-1,3-dicarboxylate |
| SMILES | COC1[C@H](C(=O)OC(C)(C)C)CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H31NO5/c1-16(2,3)22-14(19)12-10-8-9-11-18(13(12)21-7)15(20)23-17(4,5)6/h12-13H,8-11H2,1-7H3/t12-,13?/m1/s1 |
| InChIKey | SAPPLSJZMUDYKF-PZORYLMUSA-N |
| XLogP | 3.34 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |