About tert-butyl (2R)-2-methoxypyrrolidine-1-carboxylate;methanol
tert-butyl (2R)-2-methoxypyrrolidine-1-carboxylate;methanol (PubChem CID 66592390) has the molecular formula C11H23NO4
and a molecular weight of 233.31 g/mol. Its IUPAC name is tert-butyl (2R)-2-methoxypyrrolidine-1-carboxylate;methanol.
Molecular Properties
| Compound Name | tert-butyl (2R)-2-methoxypyrrolidine-1-carboxylate;methanol |
| PubChem CID | 66592390 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | tert-butyl (2R)-2-methoxypyrrolidine-1-carboxylate;methanol |
| SMILES | CO.CO[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H19NO3.CH4O/c1-10(2,3)14-9(12)11-7-5-6-8(11)13-4;1-2/h8H,5-7H2,1-4H3;2H,1H3/t8-;/m1./s1 |
| InChIKey | WXPOTLILUBKAEK-DDWIOCJRSA-N |
| XLogP | 1.60 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (2R)-2-methoxypyrrolidine-1-carboxylate;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R)-2-methoxypyrrolidine-1-carboxylate;methanol?
The IUPAC name of tert-butyl (2R)-2-methoxypyrrolidine-1-carboxylate;methanol (CID 66592390) is tert-butyl (2R)-2-methoxypyrrolidine-1-carboxylate;methanol.
What is the SMILES notation for tert-butyl (2R)-2-methoxypyrrolidine-1-carboxylate;methanol?
The canonical SMILES for tert-butyl (2R)-2-methoxypyrrolidine-1-carboxylate;methanol is CO.CO[C@@H]1CCCN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2R)-2-methoxypyrrolidine-1-carboxylate;methanol?
The InChIKey is WXPOTLILUBKAEK-DDWIOCJRSA-N. The full InChI is InChI=1S/C10H19NO3.CH4O/c1-10(2,3)14-9(12)11-7-5-6-8(11)13-4;1-2/h8H,5-7H2,1-4H3;2H,1H3/t8-;/m1./s1.
What are the key properties of tert-butyl (2R)-2-methoxypyrrolidine-1-carboxylate;methanol?
tert-butyl (2R)-2-methoxypyrrolidine-1-carboxylate;methanol has a molecular weight of 233.31 g/mol, XLogP of 1.60, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R)-2-methoxypyrrolidine-1-carboxylate;methanol is sourced from PubChem (CID 66592390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).