C20H27N3O3 — CID 97172159
tert-butyl (3S)-3-(2-quinoxalin-2-yloxyethyl)piperidine-1-carboxylate (PubChem CID 97172159) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is tert-butyl (3S)-3-(2-quinoxalin-2-yloxyethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(2-quinoxalin-2-yloxyethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97172159 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | tert-butyl (3S)-3-(2-quinoxalin-2-yloxyethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](CCOc2cnc3ccccc3n2)C1 |
| InChI | InChI=1S/C20H27N3O3/c1-20(2,3)26-19(24)23-11-6-7-15(14-23)10-12-25-18-13-21-16-8-4-5-9-17(16)22-18/h4-5,8-9,13,15H,6-7,10-12,14H2,1-3H3/t15-/m0/s1 |
| InChIKey | KRXAJLDAPPQYNE-HNNXBMFYSA-N |
| XLogP | 4.05 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |