C20H33NO4 — CID 91221582
tert-butyl 4-(furan-3-yl)-3-hexoxypiperidine-1-carboxylate (PubChem CID 91221582) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is tert-butyl 4-(furan-3-yl)-3-hexoxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(furan-3-yl)-3-hexoxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 91221582 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | tert-butyl 4-(furan-3-yl)-3-hexoxypiperidine-1-carboxylate |
| SMILES | CCCCCCOC1CN(C(=O)OC(C)(C)C)CCC1c1ccoc1 |
| InChI | InChI=1S/C20H33NO4/c1-5-6-7-8-12-24-18-14-21(19(22)25-20(2,3)4)11-9-17(18)16-10-13-23-15-16/h10,13,15,17-18H,5-9,11-12,14H2,1-4H3 |
| InChIKey | MUKXOVBKOUONLF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|