C21H33NO4 — CID 72640505
tert-butyl 3-(cyclohexylmethoxy)-4-(furan-3-yl)piperidine-1-carboxylate (PubChem CID 72640505) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is tert-butyl 3-(cyclohexylmethoxy)-4-(furan-3-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(cyclohexylmethoxy)-4-(furan-3-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 72640505 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | tert-butyl 3-(cyclohexylmethoxy)-4-(furan-3-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccoc2)C(OCC2CCCCC2)C1 |
| InChI | InChI=1S/C21H33NO4/c1-21(2,3)26-20(23)22-11-9-18(17-10-12-24-15-17)19(13-22)25-14-16-7-5-4-6-8-16/h10,12,15-16,18-19H,4-9,11,13-14H2,1-3H3 |
| InChIKey | CKDURKBNEJOOGV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |