C16H29NO4 — CID 68561852
tert-butyl 2-(cyclohexylmethoxy)morpholine-4-carboxylate (PubChem CID 68561852) has the molecular formula C16H29NO4 and a molecular weight of 299.41 g/mol. Its IUPAC name is tert-butyl 2-(cyclohexylmethoxy)morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-(cyclohexylmethoxy)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 68561852 |
| Molecular Formula | C16H29NO4 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | tert-butyl 2-(cyclohexylmethoxy)morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOC(OCC2CCCCC2)C1 |
| InChI | InChI=1S/C16H29NO4/c1-16(2,3)21-15(18)17-9-10-19-14(11-17)20-12-13-7-5-4-6-8-13/h13-14H,4-12H2,1-3H3 |
| InChIKey | FSDLGKRWARLCMP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |