C24H33N3O2S — CID 59178949
tert-butyl 4-[1-[4-(1,3-thiazol-2-yl)phenyl]piperidin-4-yl]piperidine-1-carboxylate (PubChem CID 59178949) has the molecular formula C24H33N3O2S and a molecular weight of 427.61 g/mol. Its IUPAC name is tert-butyl 4-[1-[4-(1,3-thiazol-2-yl)phenyl]piperidin-4-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[4-(1,3-thiazol-2-yl)phenyl]piperidin-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59178949 |
| Molecular Formula | C24H33N3O2S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | tert-butyl 4-[1-[4-(1,3-thiazol-2-yl)phenyl]piperidin-4-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C2CCN(c3ccc(-c4nccs4)cc3)CC2)CC1 |
| InChI | InChI=1S/C24H33N3O2S/c1-24(2,3)29-23(28)27-15-10-19(11-16-27)18-8-13-26(14-9-18)21-6-4-20(5-7-21)22-25-12-17-30-22/h4-7,12,17-19H,8-11,13-16H2,1-3H3 |
| InChIKey | MVFVBZJDIVTFJP-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|