C20H29N3O2 — CID 87152988
tert-butyl 4-(2-tert-butyl-4-isocyanophenyl)piperazine-1-carboxylate (PubChem CID 87152988) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is tert-butyl 4-(2-tert-butyl-4-isocyanophenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-tert-butyl-4-isocyanophenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87152988 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | tert-butyl 4-(2-tert-butyl-4-isocyanophenyl)piperazine-1-carboxylate |
| SMILES | [C-]#[N+]c1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H29N3O2/c1-19(2,3)16-14-15(21-7)8-9-17(16)22-10-12-23(13-11-22)18(24)25-20(4,5)6/h8-9,14H,10-13H2,1-6H3 |
| InChIKey | MJTHDCOKPWJTEO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 37.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|