C19H22N2O3 — CID 156626381
tert-butyl 6-isocyano-3-oxospiro[1H-indene-2,4'-piperidine]-1'-carboxylate (PubChem CID 156626381) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is tert-butyl 6-isocyano-3-oxospiro[1H-indene-2,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 6-isocyano-3-oxospiro[1H-indene-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 156626381 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | tert-butyl 6-isocyano-3-oxospiro[1H-indene-2,4'-piperidine]-1'-carboxylate |
| SMILES | [C-]#[N+]c1ccc2c(c1)CC1(CCN(C(=O)OC(C)(C)C)CC1)C2=O |
| InChI | InChI=1S/C19H22N2O3/c1-18(2,3)24-17(23)21-9-7-19(8-10-21)12-13-11-14(20-4)5-6-15(13)16(19)22/h5-6,11H,7-10,12H2,1-3H3 |
| InChIKey | RVCYYDJHCSMMDN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 50.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|