C22H31FN2O3S — CID 176654489
tert-butyl (3Z)-3-[(R)-tert-butylsulfinyl]imino-6-fluorospiro[1H-indene-2,4'-piperidine]-1'-carboxylate (PubChem CID 176654489) has the molecular formula C22H31FN2O3S and a molecular weight of 422.57 g/mol. Its IUPAC name is tert-butyl (3Z)-3-[(R)-tert-butylsulfinyl]imino-6-fluorospiro[1H-indene-2,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl (3Z)-3-[(R)-tert-butylsulfinyl]imino-6-fluorospiro[1H-indene-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 176654489 |
| Molecular Formula | C22H31FN2O3S |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | tert-butyl (3Z)-3-[(R)-tert-butylsulfinyl]imino-6-fluorospiro[1H-indene-2,4'-piperidine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)Cc1cc(F)ccc1/C2=N\[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C22H31FN2O3S/c1-20(2,3)28-19(26)25-11-9-22(10-12-25)14-15-13-16(23)7-8-17(15)18(22)24-29(27)21(4,5)6/h7-8,13H,9-12,14H2,1-6H3/b24-18+/t29-/m1/s1 |
| InChIKey | QPHDWWHMPKGQPR-DCJXEWPGSA-N |
| XLogP | 4.65 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|