C19H26N2O3S — CID 169304975
tert-butyl (3Z)-3-methylsulfinyliminospiro[1H-indene-2,4'-piperidine]-1'-carboxylate (PubChem CID 169304975) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is tert-butyl (3Z)-3-methylsulfinyliminospiro[1H-indene-2,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl (3Z)-3-methylsulfinyliminospiro[1H-indene-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 169304975 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | tert-butyl (3Z)-3-methylsulfinyliminospiro[1H-indene-2,4'-piperidine]-1'-carboxylate |
| SMILES | CS(=O)/N=C1\c2ccccc2CC12CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C19H26N2O3S/c1-18(2,3)24-17(22)21-11-9-19(10-12-21)13-14-7-5-6-8-15(14)16(19)20-25(4)23/h5-8H,9-13H2,1-4H3/b20-16+ |
| InChIKey | BHWCBFKZSSJOHD-CAPFRKAQSA-N |
| XLogP | 3.34 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|