C25H36N2O3S — CID 175753359
tert-butyl-[[6-cyclopropyl-1'-[(2-methylpropan-2-yl)oxycarbonyl]spiro[3H-indene-2,4'-piperidine]-1-ylidene]amino]-oxidosulfanium (PubChem CID 175753359) has the molecular formula C25H36N2O3S and a molecular weight of 444.64 g/mol. Its IUPAC name is tert-butyl-[[6-cyclopropyl-1'-[(2-methylpropan-2-yl)oxycarbonyl]spiro[3H-indene-2,4'-piperidine]-1-ylidene]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[6-cyclopropyl-1'-[(2-methylpropan-2-yl)oxycarbonyl]spiro[3H-indene-2,4'-piperidine]-1-ylidene]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175753359 |
| Molecular Formula | C25H36N2O3S |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | tert-butyl-[[6-cyclopropyl-1'-[(2-methylpropan-2-yl)oxycarbonyl]spiro[3H-indene-2,4'-piperidine]-1-ylidene]amino]-oxidosulfanium |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)Cc1ccc(C3CC3)cc1C2=N[S+]([O-])C(C)(C)C |
| InChI | InChI=1S/C25H36N2O3S/c1-23(2,3)30-22(28)27-13-11-25(12-14-27)16-19-10-9-18(17-7-8-17)15-20(19)21(25)26-31(29)24(4,5)6/h9-10,15,17H,7-8,11-14,16H2,1-6H3 |
| InChIKey | YGXLNNZOSUDUAP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|