C21H30ClN3O3S — CID 174004877
tert-butyl-[[2-chloro-1'-[(2-methylpropan-2-yl)oxycarbonyl]spiro[7H-cyclopenta[b]pyridine-6,4'-piperidine]-5-ylidene]amino]-oxidosulfanium (PubChem CID 174004877) has the molecular formula C21H30ClN3O3S and a molecular weight of 440.01 g/mol. Its IUPAC name is tert-butyl-[[2-chloro-1'-[(2-methylpropan-2-yl)oxycarbonyl]spiro[7H-cyclopenta[b]pyridine-6,4'-piperidine]-5-ylidene]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[2-chloro-1'-[(2-methylpropan-2-yl)oxycarbonyl]spiro[7H-cyclopenta[b]pyridine-6,4'-piperidine]-5-ylidene]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 174004877 |
| Molecular Formula | C21H30ClN3O3S |
| Molecular Weight | 440.01 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | tert-butyl-[[2-chloro-1'-[(2-methylpropan-2-yl)oxycarbonyl]spiro[7H-cyclopenta[b]pyridine-6,4'-piperidine]-5-ylidene]amino]-oxidosulfanium |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)Cc1nc(Cl)ccc1C2=N[S+]([O-])C(C)(C)C |
| InChI | InChI=1S/C21H30ClN3O3S/c1-19(2,3)28-18(26)25-11-9-21(10-12-25)13-15-14(7-8-16(22)23-15)17(21)24-29(27)20(4,5)6/h7-8H,9-13H2,1-6H3 |
| InChIKey | RIMYMABUXYZROH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 77.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.01 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|