C17H21ClF2N2O2 — CID 156736141
tert-butyl (1R)-1-(6-chloro-2-pyridinyl)-2,2-difluoro-6-azaspiro[2.5]octane-6-carboxylate (PubChem CID 156736141) has the molecular formula C17H21ClF2N2O2 and a molecular weight of 358.82 g/mol. Its IUPAC name is tert-butyl (1R)-1-(6-chloro-2-pyridinyl)-2,2-difluoro-6-azaspiro[2.5]octane-6-carboxylate.
| Compound Name | tert-butyl (1R)-1-(6-chloro-2-pyridinyl)-2,2-difluoro-6-azaspiro[2.5]octane-6-carboxylate |
|---|---|
| PubChem CID | 156736141 |
| Molecular Formula | C17H21ClF2N2O2 |
| Molecular Weight | 358.82 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | tert-butyl (1R)-1-(6-chloro-2-pyridinyl)-2,2-difluoro-6-azaspiro[2.5]octane-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)[C@H](c1cccc(Cl)n1)C2(F)F |
| InChI | InChI=1S/C17H21ClF2N2O2/c1-15(2,3)24-14(23)22-9-7-16(8-10-22)13(17(16,19)20)11-5-4-6-12(18)21-11/h4-6,13H,7-10H2,1-3H3/t13-/m0/s1 |
| InChIKey | GMVMQGIJBWFXAH-ZDUSSCGKSA-N |
| XLogP | 4.48 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.82 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|