C19H29ClN2O2 — CID 143781185
tert-butyl 4-[(6-chloro-2-ethyl-3-pyridinyl)methyl]-4-methylpiperidine-1-carboxylate (PubChem CID 143781185) has the molecular formula C19H29ClN2O2 and a molecular weight of 352.91 g/mol. Its IUPAC name is tert-butyl 4-[(6-chloro-2-ethyl-3-pyridinyl)methyl]-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(6-chloro-2-ethyl-3-pyridinyl)methyl]-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 143781185 |
| Molecular Formula | C19H29ClN2O2 |
| Molecular Weight | 352.91 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | tert-butyl 4-[(6-chloro-2-ethyl-3-pyridinyl)methyl]-4-methylpiperidine-1-carboxylate |
| SMILES | CCc1nc(Cl)ccc1CC1(C)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H29ClN2O2/c1-6-15-14(7-8-16(20)21-15)13-19(5)9-11-22(12-10-19)17(23)24-18(2,3)4/h7-8H,6,9-13H2,1-5H3 |
| InChIKey | UJQYLDNRMLONOL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.91 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|