C27H29ClN2O3 — CID 142379768
tert-butyl 6-(3-chloroisoquinolin-6-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carboxylate (PubChem CID 142379768) has the molecular formula C27H29ClN2O3 and a molecular weight of 464.99 g/mol. Its IUPAC name is tert-butyl 6-(3-chloroisoquinolin-6-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 6-(3-chloroisoquinolin-6-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 142379768 |
| Molecular Formula | C27H29ClN2O3 |
| Molecular Weight | 464.99 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | tert-butyl 6-(3-chloroisoquinolin-6-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCc3cc(-c4ccc5cnc(Cl)cc5c4)ccc3O2)CC1 |
| InChI | InChI=1S/C27H29ClN2O3/c1-26(2,3)33-25(31)30-12-10-27(11-13-30)9-8-20-14-19(6-7-23(20)32-27)18-4-5-21-17-29-24(28)16-22(21)15-18/h4-7,14-17H,8-13H2,1-3H3 |
| InChIKey | BLQCMKRYRMSKFI-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.99 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|