C21H31N3O3S — CID 175914169
tert-butyl-[[1'-[(2-methylpropan-2-yl)oxycarbonyl]spiro[1H-indole-2,4'-piperidine]-3-ylidene]amino]-oxidosulfanium (PubChem CID 175914169) has the molecular formula C21H31N3O3S and a molecular weight of 405.56 g/mol. Its IUPAC name is tert-butyl-[[1'-[(2-methylpropan-2-yl)oxycarbonyl]spiro[1H-indole-2,4'-piperidine]-3-ylidene]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[1'-[(2-methylpropan-2-yl)oxycarbonyl]spiro[1H-indole-2,4'-piperidine]-3-ylidene]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175914169 |
| Molecular Formula | C21H31N3O3S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | tert-butyl-[[1'-[(2-methylpropan-2-yl)oxycarbonyl]spiro[1H-indole-2,4'-piperidine]-3-ylidene]amino]-oxidosulfanium |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)Nc1ccccc1C2=N[S+]([O-])C(C)(C)C |
| InChI | InChI=1S/C21H31N3O3S/c1-19(2,3)27-18(25)24-13-11-21(12-14-24)17(23-28(26)20(4,5)6)15-9-7-8-10-16(15)22-21/h7-10,22H,11-14H2,1-6H3 |
| InChIKey | FWVGSBZFSKXFCL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|