C23H24F2N2O3 — CID 166496970
tert-butyl (3S)-3-[4-fluoro-3-[(2-fluoro-4-isocyanophenoxy)methyl]phenyl]pyrrolidine-1-carboxylate (PubChem CID 166496970) has the molecular formula C23H24F2N2O3 and a molecular weight of 414.45 g/mol. Its IUPAC name is tert-butyl (3S)-3-[4-fluoro-3-[(2-fluoro-4-isocyanophenoxy)methyl]phenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[4-fluoro-3-[(2-fluoro-4-isocyanophenoxy)methyl]phenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 166496970 |
| Molecular Formula | C23H24F2N2O3 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | tert-butyl (3S)-3-[4-fluoro-3-[(2-fluoro-4-isocyanophenoxy)methyl]phenyl]pyrrolidine-1-carboxylate |
| SMILES | [C-]#[N+]c1ccc(OCc2cc([C@@H]3CCN(C(=O)OC(C)(C)C)C3)ccc2F)c(F)c1 |
| InChI | InChI=1S/C23H24F2N2O3/c1-23(2,3)30-22(28)27-10-9-16(13-27)15-5-7-19(24)17(11-15)14-29-21-8-6-18(26-4)12-20(21)25/h5-8,11-12,16H,9-10,13-14H2,1-3H3/t16-/m1/s1 |
| InChIKey | UENKEVSAQRMKOZ-MRXNPFEDSA-N |
| XLogP | 5.82 |
| TPSA | 43.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|