C20H37IN6O3 — CID 109429892
tert-butyl 4-[2-[[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 109429892) has the molecular formula C20H37IN6O3 and a molecular weight of 536.46 g/mol. Its IUPAC name is tert-butyl 4-[2-[[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[2-[[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 109429892 |
| Molecular Formula | C20H37IN6O3 |
| Molecular Weight | 536.46 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | tert-butyl 4-[2-[[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)o1)NCCN1CCN(C(=O)OC(C)(C)C)CC1.I |
| InChI | InChI=1S/C20H36N6O3.HI/c1-7-21-18(23-14-17-24-15(2)16(3)28-17)22-8-9-25-10-12-26(13-11-25)19(27)29-20(4,5)6;/h7-14H2,1-6H3,(H2,21,22,23);1H |
| InChIKey | JZMNVPSOECMIHB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|