C21H37IN6O2 — CID 109429802
1-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine;hydroiodide (PubChem CID 109429802) has the molecular formula C21H37IN6O2 and a molecular weight of 532.47 g/mol. Its IUPAC name is 1-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109429802 |
| Molecular Formula | C21H37IN6O2 |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | 1-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)o1)NCCN1CCN(C(=O)C2CCCC2)CC1.I |
| InChI | InChI=1S/C21H36N6O2.HI/c1-4-22-21(24-15-19-25-16(2)17(3)29-19)23-9-10-26-11-13-27(14-12-26)20(28)18-7-5-6-8-18;/h18H,4-15H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | JTJMAGQGZBKZQW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 86.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|