C14H26IN5O3S — CID 109432014
2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethylguanidine;hydroiodide (PubChem CID 109432014) has the molecular formula C14H26IN5O3S and a molecular weight of 471.37 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109432014 |
| Molecular Formula | C14H26IN5O3S |
| Molecular Weight | 471.37 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)o1)NCCN1CCCS1(=O)=O.I |
| InChI | InChI=1S/C14H25N5O3S.HI/c1-4-15-14(17-10-13-18-11(2)12(3)22-13)16-6-8-19-7-5-9-23(19,20)21;/h4-10H2,1-3H3,(H2,15,16,17);1H |
| InChIKey | LKGCNZYQTKEYHQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 99.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.37 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|