C18H29F3N6OS — CID 111617916
1-[4-[[N-ethyl-N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]butyl]piperidine-4-carboxamide (PubChem CID 111617916) has the molecular formula C18H29F3N6OS and a molecular weight of 434.53 g/mol. Its IUPAC name is 1-[4-[[N-ethyl-N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]butyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[[N-ethyl-N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]butyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 111617916 |
| Molecular Formula | C18H29F3N6OS |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 1-[4-[[N-ethyl-N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]butyl]piperidine-4-carboxamide |
| SMILES | CCN/C(=N\Cc1nc(C(F)(F)F)cs1)NCCCCN1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C18H29F3N6OS/c1-2-23-17(25-11-15-26-14(12-29-15)18(19,20)21)24-7-3-4-8-27-9-5-13(6-10-27)16(22)28/h12-13H,2-11H2,1H3,(H2,22,28)(H2,23,24,25) |
| InChIKey | SKAXHRUIXGPXTC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|