C18H22ClN3O2S — CID 111502329
2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-(3,4-dihydro-2H-chromen-4-yl)-3-ethylguanidine (PubChem CID 111502329) has the molecular formula C18H22ClN3O2S and a molecular weight of 379.91 g/mol. Its IUPAC name is 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-(3,4-dihydro-2H-chromen-4-yl)-3-ethylguanidine.
| Compound Name | 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-(3,4-dihydro-2H-chromen-4-yl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111502329 |
| Molecular Formula | C18H22ClN3O2S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-(3,4-dihydro-2H-chromen-4-yl)-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)s1)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C18H22ClN3O2S/c1-2-20-18(21-11-14(23)16-7-8-17(19)25-16)22-13-9-10-24-15-6-4-3-5-12(13)15/h3-8,13-14,23H,2,9-11H2,1H3,(H2,20,21,22) |
| InChIKey | RGQQXBNZSJDQCA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|