C22H30IN3O4 — CID 111316081
1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethylguanidine;hydroiodide (PubChem CID 111316081) has the molecular formula C22H30IN3O4 and a molecular weight of 527.40 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111316081 |
| Molecular Formula | C22H30IN3O4 |
| Molecular Weight | 527.40 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cc(OC)ccc1OC)NC1CCOc2ccccc21.I |
| InChI | InChI=1S/C22H29N3O4.HI/c1-4-23-22(25-18-11-12-29-21-8-6-5-7-16(18)21)24-14-19(26)17-13-15(27-2)9-10-20(17)28-3;/h5-10,13,18-19,26H,4,11-12,14H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | YECQPJRPCZCELS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|