C24H41IN4O4 — CID 111991118
2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[1-(2-ethylbutanoyl)piperidin-4-yl]guanidine;hydroiodide (PubChem CID 111991118) has the molecular formula C24H41IN4O4 and a molecular weight of 576.52 g/mol. Its IUPAC name is 2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[1-(2-ethylbutanoyl)piperidin-4-yl]guanidine;hydroiodide.
| Compound Name | 2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[1-(2-ethylbutanoyl)piperidin-4-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111991118 |
| Molecular Formula | C24H41IN4O4 |
| Molecular Weight | 576.52 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | 2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[1-(2-ethylbutanoyl)piperidin-4-yl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cc(OC)ccc1OC)NC1CCN(C(=O)C(CC)CC)CC1.I |
| InChI | InChI=1S/C24H40N4O4.HI/c1-6-17(7-2)23(30)28-13-11-18(12-14-28)27-24(25-8-3)26-16-21(29)20-15-19(31-4)9-10-22(20)32-5;/h9-10,15,17-18,21,29H,6-8,11-14,16H2,1-5H3,(H2,25,26,27);1H |
| InChIKey | CTAAZQCPXDQMLD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|