C24H34FIN4O3 — CID 111992784
2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[1-(3-fluorophenyl)piperidin-4-yl]guanidine;hydroiodide (PubChem CID 111992784) has the molecular formula C24H34FIN4O3 and a molecular weight of 572.46 g/mol. Its IUPAC name is 2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[1-(3-fluorophenyl)piperidin-4-yl]guanidine;hydroiodide.
| Compound Name | 2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[1-(3-fluorophenyl)piperidin-4-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111992784 |
| Molecular Formula | C24H34FIN4O3 |
| Molecular Weight | 572.46 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | 2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[1-(3-fluorophenyl)piperidin-4-yl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cc(OC)ccc1OC)NC1CCN(c2cccc(F)c2)CC1.I |
| InChI | InChI=1S/C24H33FN4O3.HI/c1-4-26-24(27-16-22(30)21-15-20(31-2)8-9-23(21)32-3)28-18-10-12-29(13-11-18)19-7-5-6-17(25)14-19;/h5-9,14-15,18,22,30H,4,10-13,16H2,1-3H3,(H2,26,27,28);1H |
| InChIKey | AXYFUVVHSNAFRG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|