C24H35N5O3 — CID 111993285
2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[1-(5-methyl-2-pyridinyl)piperidin-4-yl]guanidine (PubChem CID 111993285) has the molecular formula C24H35N5O3 and a molecular weight of 441.58 g/mol. Its IUPAC name is 2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[1-(5-methyl-2-pyridinyl)piperidin-4-yl]guanidine.
| Compound Name | 2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[1-(5-methyl-2-pyridinyl)piperidin-4-yl]guanidine |
|---|---|
| PubChem CID | 111993285 |
| Molecular Formula | C24H35N5O3 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | 2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[1-(5-methyl-2-pyridinyl)piperidin-4-yl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1cc(OC)ccc1OC)NC1CCN(c2ccc(C)cn2)CC1 |
| InChI | InChI=1S/C24H35N5O3/c1-5-25-24(27-16-21(30)20-14-19(31-3)7-8-22(20)32-4)28-18-10-12-29(13-11-18)23-9-6-17(2)15-26-23/h6-9,14-15,18,21,30H,5,10-13,16H2,1-4H3,(H2,25,27,28) |
| InChIKey | FUYPCHKDNRASTD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|