C23H33N5O2 — CID 111994371
2-[(3-ethoxy-4-hydroxyphenyl)methyl]-1-ethyl-3-[1-(5-methyl-2-pyridinyl)piperidin-4-yl]guanidine (PubChem CID 111994371) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 2-[(3-ethoxy-4-hydroxyphenyl)methyl]-1-ethyl-3-[1-(5-methyl-2-pyridinyl)piperidin-4-yl]guanidine.
| Compound Name | 2-[(3-ethoxy-4-hydroxyphenyl)methyl]-1-ethyl-3-[1-(5-methyl-2-pyridinyl)piperidin-4-yl]guanidine |
|---|---|
| PubChem CID | 111994371 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 2-[(3-ethoxy-4-hydroxyphenyl)methyl]-1-ethyl-3-[1-(5-methyl-2-pyridinyl)piperidin-4-yl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(O)c(OCC)c1)NC1CCN(c2ccc(C)cn2)CC1 |
| InChI | InChI=1S/C23H33N5O2/c1-4-24-23(26-16-18-7-8-20(29)21(14-18)30-5-2)27-19-10-12-28(13-11-19)22-9-6-17(3)15-25-22/h6-9,14-15,19,29H,4-5,10-13,16H2,1-3H3,(H2,24,26,27) |
| InChIKey | RJIOAPHORMBYGL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|