C22H39N7 — CID 111019773
1-ethyl-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-(1-propylpiperidin-4-yl)guanidine (PubChem CID 111019773) has the molecular formula C22H39N7 and a molecular weight of 401.60 g/mol. Its IUPAC name is 1-ethyl-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-(1-propylpiperidin-4-yl)guanidine.
| Compound Name | 1-ethyl-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-(1-propylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 111019773 |
| Molecular Formula | C22H39N7 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.33 |
| IUPAC Name | 1-ethyl-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-(1-propylpiperidin-4-yl)guanidine |
| SMILES | CCCN1CCC(N/C(=N/Cc2ccc(N3CCN(C)CC3)nc2)NCC)CC1 |
| InChI | InChI=1S/C22H39N7/c1-4-10-28-11-8-20(9-12-28)26-22(23-5-2)25-18-19-6-7-21(24-17-19)29-15-13-27(3)14-16-29/h6-7,17,20H,4-5,8-16,18H2,1-3H3,(H2,23,25,26) |
| InChIKey | TTZIGPFFRBUWSI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 59.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|