C10H12ClNO4S2 — CID 114232220
2-[1-(5-chlorothiophen-2-yl)-1-oxopropan-2-yl]sulfonyl-N-methylacetamide (PubChem CID 114232220) has the molecular formula C10H12ClNO4S2 and a molecular weight of 309.80 g/mol. Its IUPAC name is 2-[1-(5-chlorothiophen-2-yl)-1-oxopropan-2-yl]sulfonyl-N-methylacetamide.
| Compound Name | 2-[1-(5-chlorothiophen-2-yl)-1-oxopropan-2-yl]sulfonyl-N-methylacetamide |
|---|---|
| PubChem CID | 114232220 |
| Molecular Formula | C10H12ClNO4S2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | 2-[1-(5-chlorothiophen-2-yl)-1-oxopropan-2-yl]sulfonyl-N-methylacetamide |
| SMILES | CNC(=O)CS(=O)(=O)C(C)C(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H12ClNO4S2/c1-6(18(15,16)5-9(13)12-2)10(14)7-3-4-8(11)17-7/h3-4,6H,5H2,1-2H3,(H,12,13) |
| InChIKey | ZTQOTMCLSKNKBB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |