C11H16ClNOS — CID 82085991
3-(5-chlorothiophen-2-yl)-N,4-dimethylpentanamide (PubChem CID 82085991) has the molecular formula C11H16ClNOS and a molecular weight of 245.77 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)-N,4-dimethylpentanamide.
| Compound Name | 3-(5-chlorothiophen-2-yl)-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 82085991 |
| Molecular Formula | C11H16ClNOS |
| Molecular Weight | 245.77 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)-N,4-dimethylpentanamide |
| SMILES | CNC(=O)CC(c1ccc(Cl)s1)C(C)C |
| InChI | InChI=1S/C11H16ClNOS/c1-7(2)8(6-11(14)13-3)9-4-5-10(12)15-9/h4-5,7-8H,6H2,1-3H3,(H,13,14) |
| InChIKey | XPUJZBKBBAWHJL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.77 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |