C10H15ClN2OS — CID 103932076
(2R)-2-[1-(5-chlorothiophen-2-yl)ethylamino]-N-methylpropanamide (PubChem CID 103932076) has the molecular formula C10H15ClN2OS and a molecular weight of 246.76 g/mol. Its IUPAC name is (2R)-2-[1-(5-chlorothiophen-2-yl)ethylamino]-N-methylpropanamide.
| Compound Name | (2R)-2-[1-(5-chlorothiophen-2-yl)ethylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 103932076 |
| Molecular Formula | C10H15ClN2OS |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | (2R)-2-[1-(5-chlorothiophen-2-yl)ethylamino]-N-methylpropanamide |
| SMILES | CNC(=O)[C@@H](C)NC(C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H15ClN2OS/c1-6(8-4-5-9(11)15-8)13-7(2)10(14)12-3/h4-7,13H,1-3H3,(H,12,14)/t6?,7-/m1/s1 |
| InChIKey | CNAZADWBSUOVHR-COBSHVIPSA-N |
| XLogP | 2.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |