C11H17ClN2OS — CID 103875860
2-[1-(5-chlorothiophen-2-yl)ethylamino]-3-methylbutanamide (PubChem CID 103875860) has the molecular formula C11H17ClN2OS and a molecular weight of 260.79 g/mol. Its IUPAC name is 2-[1-(5-chlorothiophen-2-yl)ethylamino]-3-methylbutanamide.
| Compound Name | 2-[1-(5-chlorothiophen-2-yl)ethylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 103875860 |
| Molecular Formula | C11H17ClN2OS |
| Molecular Weight | 260.79 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2-[1-(5-chlorothiophen-2-yl)ethylamino]-3-methylbutanamide |
| SMILES | CC(NC(C(N)=O)C(C)C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H17ClN2OS/c1-6(2)10(11(13)15)14-7(3)8-4-5-9(12)16-8/h4-7,10,14H,1-3H3,(H2,13,15) |
| InChIKey | XBBYJNVWZPUKMB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.79 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |