C20H21BrN2OS — CID 8653646
3-(3-bromophenyl)-N-ethyl-3-oxo-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)propanimidothioate (PubChem CID 8653646) has the molecular formula C20H21BrN2OS and a molecular weight of 417.37 g/mol. Its IUPAC name is 3-(3-bromophenyl)-N-ethyl-3-oxo-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)propanimidothioate.
| Compound Name | 3-(3-bromophenyl)-N-ethyl-3-oxo-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)propanimidothioate |
|---|---|
| PubChem CID | 8653646 |
| Molecular Formula | C20H21BrN2OS |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 3-(3-bromophenyl)-N-ethyl-3-oxo-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)propanimidothioate |
| SMILES | CC/N=C(\[S-])C(C(=O)c1cccc(Br)c1)[n+]1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C20H21BrN2OS/c1-2-22-20(25)18(19(24)15-8-5-9-17(21)12-15)23-11-10-14-6-3-4-7-16(14)13-23/h5,8-13,18H,2-4,6-7H2,1H3 |
| InChIKey | XJJDIVQCELRBQZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 33.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|