C16H17Cl2NO2S — CID 55364221
2-(2,5-dichlorophenyl)sulfanyl-N-[4-(furan-2-yl)butan-2-yl]acetamide (PubChem CID 55364221) has the molecular formula C16H17Cl2NO2S and a molecular weight of 358.29 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanyl-N-[4-(furan-2-yl)butan-2-yl]acetamide.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanyl-N-[4-(furan-2-yl)butan-2-yl]acetamide |
|---|---|
| PubChem CID | 55364221 |
| Molecular Formula | C16H17Cl2NO2S |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanyl-N-[4-(furan-2-yl)butan-2-yl]acetamide |
| SMILES | CC(CCc1ccco1)NC(=O)CSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H17Cl2NO2S/c1-11(4-6-13-3-2-8-21-13)19-16(20)10-22-15-9-12(17)5-7-14(15)18/h2-3,5,7-9,11H,4,6,10H2,1H3,(H,19,20) |
| InChIKey | HVVWXYFMOWBOPB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |