C21H22ClN3O3 — CID 34519138
(2S)-2-(4-chloro-2,6-dimethylphenoxy)-N'-[2-(1H-indol-3-yl)acetyl]propanehydrazide (PubChem CID 34519138) has the molecular formula C21H22ClN3O3 and a molecular weight of 399.88 g/mol. Its IUPAC name is (2S)-2-(4-chloro-2,6-dimethylphenoxy)-N'-[2-(1H-indol-3-yl)acetyl]propanehydrazide.
| Compound Name | (2S)-2-(4-chloro-2,6-dimethylphenoxy)-N'-[2-(1H-indol-3-yl)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 34519138 |
| Molecular Formula | C21H22ClN3O3 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | (2S)-2-(4-chloro-2,6-dimethylphenoxy)-N'-[2-(1H-indol-3-yl)acetyl]propanehydrazide |
| SMILES | Cc1cc(Cl)cc(C)c1O[C@@H](C)C(=O)NNC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H22ClN3O3/c1-12-8-16(22)9-13(2)20(12)28-14(3)21(27)25-24-19(26)10-15-11-23-18-7-5-4-6-17(15)18/h4-9,11,14,23H,10H2,1-3H3,(H,24,26)(H,25,27)/t14-/m0/s1 |
| InChIKey | PLBXASZJYDEHIJ-AWEZNQCLSA-N |
| XLogP | 3.60 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|