C20H21N3O2S — CID 17484675
N'-[2-(1H-indol-3-yl)acetyl]-2-(4-methylphenyl)sulfanylpropanehydrazide (PubChem CID 17484675) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is N'-[2-(1H-indol-3-yl)acetyl]-2-(4-methylphenyl)sulfanylpropanehydrazide.
| Compound Name | N'-[2-(1H-indol-3-yl)acetyl]-2-(4-methylphenyl)sulfanylpropanehydrazide |
|---|---|
| PubChem CID | 17484675 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N'-[2-(1H-indol-3-yl)acetyl]-2-(4-methylphenyl)sulfanylpropanehydrazide |
| SMILES | Cc1ccc(SC(C)C(=O)NNC(=O)Cc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C20H21N3O2S/c1-13-7-9-16(10-8-13)26-14(2)20(25)23-22-19(24)11-15-12-21-18-6-4-3-5-17(15)18/h3-10,12,14,21H,11H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | NKBZFACHRCITBJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|