C15H21FN4O4 — CID 9372574
[(2S)-1-[2-[(2S)-2-(2-fluorophenoxy)propanoyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]urea (PubChem CID 9372574) has the molecular formula C15H21FN4O4 and a molecular weight of 340.36 g/mol. Its IUPAC name is [(2S)-1-[2-[(2S)-2-(2-fluorophenoxy)propanoyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]urea.
| Compound Name | [(2S)-1-[2-[(2S)-2-(2-fluorophenoxy)propanoyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]urea |
|---|---|
| PubChem CID | 9372574 |
| Molecular Formula | C15H21FN4O4 |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | [(2S)-1-[2-[(2S)-2-(2-fluorophenoxy)propanoyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]urea |
| SMILES | CC(C)[C@H](NC(N)=O)C(=O)NNC(=O)[C@H](C)Oc1ccccc1F |
| InChI | InChI=1S/C15H21FN4O4/c1-8(2)12(18-15(17)23)14(22)20-19-13(21)9(3)24-11-7-5-4-6-10(11)16/h4-9,12H,1-3H3,(H,19,21)(H,20,22)(H3,17,18,23)/t9-,12-/m0/s1 |
| InChIKey | IVEPRIFSRBUHAK-CABZTGNLSA-N |
| XLogP | 0.43 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|