C19H21FN4O4 — CID 18286571
[3-[2-[2-(2-fluorophenoxy)propanoyl]hydrazinyl]-3-oxo-1-phenylpropyl]urea (PubChem CID 18286571) has the molecular formula C19H21FN4O4 and a molecular weight of 388.40 g/mol. Its IUPAC name is [3-[2-[2-(2-fluorophenoxy)propanoyl]hydrazinyl]-3-oxo-1-phenylpropyl]urea.
| Compound Name | [3-[2-[2-(2-fluorophenoxy)propanoyl]hydrazinyl]-3-oxo-1-phenylpropyl]urea |
|---|---|
| PubChem CID | 18286571 |
| Molecular Formula | C19H21FN4O4 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | [3-[2-[2-(2-fluorophenoxy)propanoyl]hydrazinyl]-3-oxo-1-phenylpropyl]urea |
| SMILES | CC(Oc1ccccc1F)C(=O)NNC(=O)CC(NC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C19H21FN4O4/c1-12(28-16-10-6-5-9-14(16)20)18(26)24-23-17(25)11-15(22-19(21)27)13-7-3-2-4-8-13/h2-10,12,15H,11H2,1H3,(H,23,25)(H,24,26)(H3,21,22,27) |
| InChIKey | ZLADQHLRQUGPJZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|