C17H18FN3O4 — CID 51980854
1-[[(2R)-2-(2-fluorophenoxy)propanoyl]amino]-3-(2-methoxyphenyl)urea (PubChem CID 51980854) has the molecular formula C17H18FN3O4 and a molecular weight of 347.35 g/mol. Its IUPAC name is 1-[[(2R)-2-(2-fluorophenoxy)propanoyl]amino]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[[(2R)-2-(2-fluorophenoxy)propanoyl]amino]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 51980854 |
| Molecular Formula | C17H18FN3O4 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 1-[[(2R)-2-(2-fluorophenoxy)propanoyl]amino]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)NNC(=O)[C@@H](C)Oc1ccccc1F |
| InChI | InChI=1S/C17H18FN3O4/c1-11(25-14-9-5-3-7-12(14)18)16(22)20-21-17(23)19-13-8-4-6-10-15(13)24-2/h3-11H,1-2H3,(H,20,22)(H2,19,21,23)/t11-/m1/s1 |
| InChIKey | INVSEMOIEICYBO-LLVKDONJSA-N |
| XLogP | 2.45 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|