C18H19Cl2N3O4S — CID 2957216
1-[2-(3,4-dichlorophenoxy)propanoylamino]-3-(3,4-dimethoxyphenyl)thiourea (PubChem CID 2957216) has the molecular formula C18H19Cl2N3O4S and a molecular weight of 444.34 g/mol. Its IUPAC name is 1-[2-(3,4-dichlorophenoxy)propanoylamino]-3-(3,4-dimethoxyphenyl)thiourea.
| Compound Name | 1-[2-(3,4-dichlorophenoxy)propanoylamino]-3-(3,4-dimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 2957216 |
| Molecular Formula | C18H19Cl2N3O4S |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | 1-[2-(3,4-dichlorophenoxy)propanoylamino]-3-(3,4-dimethoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)NNC(=O)C(C)Oc2ccc(Cl)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C18H19Cl2N3O4S/c1-10(27-12-5-6-13(19)14(20)9-12)17(24)22-23-18(28)21-11-4-7-15(25-2)16(8-11)26-3/h4-10H,1-3H3,(H,22,24)(H2,21,23,28) |
| InChIKey | WFHYYEJOOCBCRP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|