C24H25N3O4S — CID 25238488
1-(3,4-dimethoxyphenyl)-3-[2-(4-phenylphenoxy)propanoylamino]thiourea (PubChem CID 25238488) has the molecular formula C24H25N3O4S and a molecular weight of 451.55 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-[2-(4-phenylphenoxy)propanoylamino]thiourea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-[2-(4-phenylphenoxy)propanoylamino]thiourea |
|---|---|
| PubChem CID | 25238488 |
| Molecular Formula | C24H25N3O4S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-[2-(4-phenylphenoxy)propanoylamino]thiourea |
| SMILES | COc1ccc(NC(=S)NNC(=O)C(C)Oc2ccc(-c3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C24H25N3O4S/c1-16(31-20-12-9-18(10-13-20)17-7-5-4-6-8-17)23(28)26-27-24(32)25-19-11-14-21(29-2)22(15-19)30-3/h4-16H,1-3H3,(H,26,28)(H2,25,27,32) |
| InChIKey | JGOLSCUBFWBNHY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|