C22H19Cl2N3O2S — CID 25238479
1-(3,5-dichlorophenyl)-3-[2-(4-phenylphenoxy)propanoylamino]thiourea (PubChem CID 25238479) has the molecular formula C22H19Cl2N3O2S and a molecular weight of 460.39 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[2-(4-phenylphenoxy)propanoylamino]thiourea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[2-(4-phenylphenoxy)propanoylamino]thiourea |
|---|---|
| PubChem CID | 25238479 |
| Molecular Formula | C22H19Cl2N3O2S |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[2-(4-phenylphenoxy)propanoylamino]thiourea |
| SMILES | CC(Oc1ccc(-c2ccccc2)cc1)C(=O)NNC(=S)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C22H19Cl2N3O2S/c1-14(29-20-9-7-16(8-10-20)15-5-3-2-4-6-15)21(28)26-27-22(30)25-19-12-17(23)11-18(24)13-19/h2-14H,1H3,(H,26,28)(H2,25,27,30) |
| InChIKey | BXGXVVUEVSPKGQ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|