C11H12ClNO4 — CID 106501475
methyl 3-[(2-chloro-5-hydroxybenzoyl)amino]propanoate (PubChem CID 106501475) has the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. Its IUPAC name is methyl 3-[(2-chloro-5-hydroxybenzoyl)amino]propanoate.
| Compound Name | methyl 3-[(2-chloro-5-hydroxybenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 106501475 |
| Molecular Formula | C11H12ClNO4 |
| Molecular Weight | 257.67 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | methyl 3-[(2-chloro-5-hydroxybenzoyl)amino]propanoate |
| SMILES | COC(=O)CCNC(=O)c1cc(O)ccc1Cl |
| InChI | InChI=1S/C11H12ClNO4/c1-17-10(15)4-5-13-11(16)8-6-7(14)2-3-9(8)12/h2-3,6,14H,4-5H2,1H3,(H,13,16) |
| InChIKey | SWCWAFCXGGQJDY-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.67 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |