C18H26N2O5S — CID 8767975
methyl 2-methoxy-5-[[(6-methoxy-6-oxohexyl)carbamothioylamino]methyl]benzoate (PubChem CID 8767975) has the molecular formula C18H26N2O5S and a molecular weight of 382.48 g/mol. Its IUPAC name is methyl 2-methoxy-5-[[(6-methoxy-6-oxohexyl)carbamothioylamino]methyl]benzoate.
| Compound Name | methyl 2-methoxy-5-[[(6-methoxy-6-oxohexyl)carbamothioylamino]methyl]benzoate |
|---|---|
| PubChem CID | 8767975 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | methyl 2-methoxy-5-[[(6-methoxy-6-oxohexyl)carbamothioylamino]methyl]benzoate |
| SMILES | COC(=O)CCCCCNC(=S)NCc1ccc(OC)c(C(=O)OC)c1 |
| InChI | InChI=1S/C18H26N2O5S/c1-23-15-9-8-13(11-14(15)17(22)25-3)12-20-18(26)19-10-6-4-5-7-16(21)24-2/h8-9,11H,4-7,10,12H2,1-3H3,(H2,19,20,26) |
| InChIKey | JVQZOPRIKSSINO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|